C27H23FN2O2 — CID 54666225
[(3aR,4S,9bR)-8-[2-(2-fluorophenyl)ethynyl]-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-phenylmethanone (PubChem CID 54666225) has the molecular formula C27H23FN2O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is [(3aR,4S,9bR)-8-[2-(2-fluorophenyl)ethynyl]-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,9bR)-8-[2-(2-fluorophenyl)ethynyl]-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 54666225 |
| Molecular Formula | C27H23FN2O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(3aR,4S,9bR)-8-[2-(2-fluorophenyl)ethynyl]-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CC[C@@H]2[C@@H](CO)Nc3ccc(C#Cc4ccccc4F)cc3[C@@H]21 |
| InChI | InChI=1S/C27H23FN2O2/c28-23-9-5-4-6-19(23)12-10-18-11-13-24-22(16-18)26-21(25(17-31)29-24)14-15-30(26)27(32)20-7-2-1-3-8-20/h1-9,11,13,16,21,25-26,29,31H,14-15,17H2/t21-,25-,26-/m1/s1 |
| InChIKey | OHYIHDQBOUYLLW-LPPUWEFUSA-N |
| XLogP | 4.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|