C24H28FN3O3 — CID 54665497
1-[(3aS,4R,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 54665497) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is 1-[(3aS,4R,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[(3aS,4R,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 54665497 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[(3aS,4R,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | O=C(CN1CCOCC1)N1CC[C@H]2[C@H](CO)Nc3ccc(-c4ccc(F)cc4)cc3[C@H]21 |
| InChI | InChI=1S/C24H28FN3O3/c25-18-4-1-16(2-5-18)17-3-6-21-20(13-17)24-19(22(15-29)26-21)7-8-28(24)23(30)14-27-9-11-31-12-10-27/h1-6,13,19,22,24,26,29H,7-12,14-15H2/t19-,22-,24-/m0/s1 |
| InChIKey | WJGZJFFPIQYOOB-APTRMMRNSA-N |
| XLogP | 2.50 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |