C24H27FN2O3 — CID 54665062
[(3aS,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(oxan-4-yl)methanone (PubChem CID 54665062) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is [(3aS,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [(3aS,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 54665062 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [(3aS,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CC[C@H]2[C@H](CO)Nc3ccc(-c4cccc(F)c4)cc3[C@H]21 |
| InChI | InChI=1S/C24H27FN2O3/c25-18-3-1-2-16(12-18)17-4-5-21-20(13-17)23-19(22(14-28)26-21)6-9-27(23)24(29)15-7-10-30-11-8-15/h1-5,12-13,15,19,22-23,26,28H,6-11,14H2/t19-,22-,23-/m0/s1 |
| InChIKey | MWKSBEGZIHONLC-VJBMBRPKSA-N |
| XLogP | 3.60 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |