C27H28N2O3 — CID 170281104
benzyl (3aR,4S,9bR)-4-(hydroxymethyl)-8-(4-methylphenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate (PubChem CID 170281104) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is benzyl (3aR,4S,9bR)-4-(hydroxymethyl)-8-(4-methylphenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate.
| Compound Name | benzyl (3aR,4S,9bR)-4-(hydroxymethyl)-8-(4-methylphenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 170281104 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | benzyl (3aR,4S,9bR)-4-(hydroxymethyl)-8-(4-methylphenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
| SMILES | Cc1ccc(-c2ccc3c(c2)[C@H]2[C@H](CCN2C(=O)OCc2ccccc2)[C@@H](CO)N3)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-18-7-9-20(10-8-18)21-11-12-24-23(15-21)26-22(25(16-30)28-24)13-14-29(26)27(31)32-17-19-5-3-2-4-6-19/h2-12,15,22,25-26,28,30H,13-14,16-17H2,1H3/t22-,25-,26-/m1/s1 |
| InChIKey | ZLEBVIMTLSWVIW-DNRSQYFGSA-N |
| XLogP | 5.15 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |