C23H28N2O2 — CID 67150720
tert-butyl (4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate (PubChem CID 67150720) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl (4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate.
| Compound Name | tert-butyl (4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 67150720 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl (4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]2[C@H]1c1ccccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H28N2O2/c1-23(2,3)27-22(26)25-15-9-13-18-20(16-10-5-4-6-11-16)24-19-14-8-7-12-17(19)21(18)25/h4-8,10-12,14,18,20-21,24H,9,13,15H2,1-3H3/t18-,20-,21+/m0/s1 |
| InChIKey | OCPPRJKFXMIYHK-SESVDKBCSA-N |
| XLogP | 5.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |