C23H28N2O2 — CID 67150721
(4aS,5R,10bS)-5-(2-tert-butylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylic acid (PubChem CID 67150721) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-(2-tert-butylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylic acid.
| Compound Name | (4aS,5R,10bS)-5-(2-tert-butylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 67150721 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (4aS,5R,10bS)-5-(2-tert-butylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylic acid |
| SMILES | CC(C)(C)c1ccccc1[C@@H]1Nc2ccccc2[C@@H]2[C@H]1CCCN2C(=O)O |
| InChI | InChI=1S/C23H28N2O2/c1-23(2,3)18-12-6-4-9-15(18)20-17-11-8-14-25(22(26)27)21(17)16-10-5-7-13-19(16)24-20/h4-7,9-10,12-13,17,20-21,24H,8,11,14H2,1-3H3,(H,26,27)/t17-,20-,21+/m0/s1 |
| InChIKey | AGGOVXSAQWZYAF-DZFGPLHGSA-N |
| XLogP | 5.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |