C30H33N3O3 — CID 67150689
N-[(1R,2S)-2-[(3aS,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide (PubChem CID 67150689) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(3aS,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide.
| Compound Name | N-[(1R,2S)-2-[(3aS,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 67150689 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | N-[(1R,2S)-2-[(3aS,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
| SMILES | Cc1occc1[C@@H]1Nc2ccccc2[C@H]2[C@H]1CCN2C(=O)[C@H]1CCCC[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H33N3O3/c1-19-21(16-18-36-19)27-24-15-17-33(28(24)22-11-5-7-13-25(22)31-27)30(35)23-12-6-8-14-26(23)32-29(34)20-9-3-2-4-10-20/h2-5,7,9-11,13,16,18,23-24,26-28,31H,6,8,12,14-15,17H2,1H3,(H,32,34)/t23-,24-,26+,27-,28-/m0/s1 |
| InChIKey | CYXBDSNAGGFJMK-DDEQHYEBSA-N |
| XLogP | 5.63 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |