C27H34N4O2 — CID 68574438
N-[(1R,2S)-2-[4-(methylaminomethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide (PubChem CID 68574438) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[(1R,2S)-2-[4-(methylaminomethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide.
| Compound Name | N-[(1R,2S)-2-[4-(methylaminomethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 68574438 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[(1R,2S)-2-[4-(methylaminomethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
| SMILES | CNCC1Nc2ccccc2C2C1CCN2C(=O)[C@H]1CCCC[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H34N4O2/c1-28-17-24-20-15-16-31(25(20)19-11-5-7-13-22(19)29-24)27(33)21-12-6-8-14-23(21)30-26(32)18-9-3-2-4-10-18/h2-5,7,9-11,13,20-21,23-25,28-29H,6,8,12,14-17H2,1H3,(H,30,32)/t20?,21-,23+,24?,25?/m0/s1 |
| InChIKey | KSLVPOPTSIKRNA-DEDHTJSNSA-N |
| XLogP | 3.58 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |