C33H44N4O5 — CID 69070447
[4-[[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]carbamoyl]phenyl]methyl-tert-butylcarbamic acid (PubChem CID 69070447) has the molecular formula C33H44N4O5 and a molecular weight of 576.74 g/mol. Its IUPAC name is [4-[[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]carbamoyl]phenyl]methyl-tert-butylcarbamic acid.
| Compound Name | [4-[[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]carbamoyl]phenyl]methyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 69070447 |
| Molecular Formula | C33H44N4O5 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | [4-[[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]carbamoyl]phenyl]methyl-tert-butylcarbamic acid |
| SMILES | COC[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CCN2C(=O)[C@H]1CCCC[C@H]1NC(=O)c1ccc(CN(C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H44N4O5/c1-33(2,3)37(32(40)41)19-21-13-15-22(16-14-21)30(38)35-27-12-8-6-10-25(27)31(39)36-18-17-24-28(20-42-4)34-26-11-7-5-9-23(26)29(24)36/h5,7,9,11,13-16,24-25,27-29,34H,6,8,10,12,17-20H2,1-4H3,(H,35,38)(H,40,41)/t24-,25+,27-,28+,29+/m1/s1 |
| InChIKey | RGFVFIVUBSFTSD-IGLFNLRGSA-N |
| XLogP | 5.28 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |