C30H38N6O3 — CID 70962882
1-[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-[4-(4,5-dihydroimidazol-1-yl)phenyl]urea (PubChem CID 70962882) has the molecular formula C30H38N6O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-[4-(4,5-dihydroimidazol-1-yl)phenyl]urea.
| Compound Name | 1-[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-[4-(4,5-dihydroimidazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 70962882 |
| Molecular Formula | C30H38N6O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 1-[(1R,2S)-2-[(3aR,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-[4-(4,5-dihydroimidazol-1-yl)phenyl]urea |
| SMILES | COC[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CCN2C(=O)[C@H]1CCCC[C@H]1NC(=O)Nc1ccc(N2C=NCC2)cc1 |
| InChI | InChI=1S/C30H38N6O3/c1-39-18-27-23-14-16-36(28(23)22-6-2-4-8-25(22)33-27)29(37)24-7-3-5-9-26(24)34-30(38)32-20-10-12-21(13-11-20)35-17-15-31-19-35/h2,4,6,8,10-13,19,23-24,26-28,33H,3,5,7,9,14-18H2,1H3,(H2,32,34,38)/t23-,24+,26-,27+,28+/m1/s1 |
| InChIKey | ZGPZQQKNIUDEPD-BHHQIGSJSA-N |
| XLogP | 4.25 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |