C27H34N4O3 — CID 67150752
1-[(1R,2S)-2-[(3aS,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea (PubChem CID 67150752) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea.
| Compound Name | 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea |
|---|---|
| PubChem CID | 67150752 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea |
| SMILES | COC[C@@H]1Nc2ccccc2[C@H]2[C@H]1CCN2C(=O)[C@H]1CCCC[C@H]1NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H34N4O3/c1-34-17-24-20-15-16-31(25(20)19-11-5-7-13-22(19)29-24)26(32)21-12-6-8-14-23(21)30-27(33)28-18-9-3-2-4-10-18/h2-5,7,9-11,13,20-21,23-25,29H,6,8,12,14-17H2,1H3,(H2,28,30,33)/t20-,21-,23+,24-,25-/m0/s1 |
| InChIKey | SJGLVCOCTCCBIF-XPVPTZRYSA-N |
| XLogP | 4.40 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |