C28H33N5O3 — CID 69083842
1-(4-cyanophenyl)-3-[2-[4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]urea (PubChem CID 69083842) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[2-[4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[2-[4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]urea |
|---|---|
| PubChem CID | 69083842 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[2-[4-(methoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]urea |
| SMILES | COCC1Nc2ccccc2C2C1CCN2C(=O)C1CCCCC1NC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H33N5O3/c1-36-17-25-21-14-15-33(26(21)20-6-2-4-8-23(20)31-25)27(34)22-7-3-5-9-24(22)32-28(35)30-19-12-10-18(16-29)11-13-19/h2,4,6,8,10-13,21-22,24-26,31H,3,5,7,9,14-15,17H2,1H3,(H2,30,32,35) |
| InChIKey | YFNMFENLUVWXNA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |