C27H31F3N4O2 — CID 69084773
1-[2-(4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 69084773) has the molecular formula C27H31F3N4O2 and a molecular weight of 500.57 g/mol. Its IUPAC name is 1-[2-(4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 69084773 |
| Molecular Formula | C27H31F3N4O2 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 1-[2-(4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NC1CCCCC1C(=O)N1CCC2C(c3ccccc3)Nc3ccccc3C21 |
| InChI | InChI=1S/C27H31F3N4O2/c28-27(29,30)16-31-26(36)33-22-13-7-5-11-19(22)25(35)34-15-14-20-23(17-8-2-1-3-9-17)32-21-12-6-4-10-18(21)24(20)34/h1-4,6,8-10,12,19-20,22-24,32H,5,7,11,13-16H2,(H2,31,33,36) |
| InChIKey | UGOOSWPGNIJYBZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |