C32H43N5O3 — CID 67150590
1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 67150590) has the molecular formula C32H43N5O3 and a molecular weight of 545.73 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 67150590 |
| Molecular Formula | C32H43N5O3 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | O=C(NCCCN1CCOCC1)N[C@@H]1CCCC[C@@H]1C(=O)N1CC[C@H]2[C@H](c3ccccc3)Nc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C32H43N5O3/c38-31(25-12-5-7-14-28(25)35-32(39)33-16-8-17-36-19-21-40-22-20-36)37-18-15-26-29(23-9-2-1-3-10-23)34-27-13-6-4-11-24(27)30(26)37/h1-4,6,9-11,13,25-26,28-30,34H,5,7-8,12,14-22H2,(H2,33,35,39)/t25-,26-,28+,29-,30-/m0/s1 |
| InChIKey | VLPIHCNEYZYRPE-KRVZZJCRSA-N |
| XLogP | 4.32 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|