C36H39N5O3 — CID 68574279
N-[(1R,2S)-2-[4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide (PubChem CID 68574279) has the molecular formula C36H39N5O3 and a molecular weight of 589.74 g/mol. Its IUPAC name is N-[(1R,2S)-2-[4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide.
| Compound Name | N-[(1R,2S)-2-[4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 68574279 |
| Molecular Formula | C36H39N5O3 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | N-[(1R,2S)-2-[4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
| SMILES | COc1ccc(Cn2ccnc2C2Nc3ccccc3C3C2CCN3C(=O)[C@H]2CCCC[C@H]2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H39N5O3/c1-44-26-17-15-24(16-18-26)23-40-22-20-37-34(40)32-29-19-21-41(33(29)27-11-5-7-13-30(27)38-32)36(43)28-12-6-8-14-31(28)39-35(42)25-9-3-2-4-10-25/h2-5,7,9-11,13,15-18,20,22,28-29,31-33,38H,6,8,12,14,19,21,23H2,1H3,(H,39,42)/t28-,29?,31+,32?,33?/m0/s1 |
| InChIKey | ICLITDDSHZESGC-ITQDOPFWSA-N |
| XLogP | 5.99 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |