C31H32FN3O2 — CID 68986214
N-[(1R,2S)-2-[4-(4-fluorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide (PubChem CID 68986214) has the molecular formula C31H32FN3O2 and a molecular weight of 497.61 g/mol. Its IUPAC name is N-[(1R,2S)-2-[4-(4-fluorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide.
| Compound Name | N-[(1R,2S)-2-[4-(4-fluorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 68986214 |
| Molecular Formula | C31H32FN3O2 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | N-[(1R,2S)-2-[4-(4-fluorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1C(=O)N1CCC2C(c3ccc(F)cc3)Nc3ccccc3C21)c1ccccc1 |
| InChI | InChI=1S/C31H32FN3O2/c32-22-16-14-20(15-17-22)28-25-18-19-35(29(25)23-10-4-6-12-26(23)33-28)31(37)24-11-5-7-13-27(24)34-30(36)21-8-2-1-3-9-21/h1-4,6,8-10,12,14-17,24-25,27-29,33H,5,7,11,13,18-19H2,(H,34,36)/t24-,25?,27+,28?,29?/m0/s1 |
| InChIKey | LNXZJANRTAMOEM-YFMDWWQMSA-N |
| XLogP | 5.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |