C31H34N4O2 — CID 67150522
1-[(1R,2S)-2-[(3aR,4S,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea (PubChem CID 67150522) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(3aR,4S,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea.
| Compound Name | 1-[(1R,2S)-2-[(3aR,4S,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea |
|---|---|
| PubChem CID | 67150522 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 1-[(1R,2S)-2-[(3aR,4S,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@@H]1CCCC[C@@H]1C(=O)N1CC[C@@H]2[C@@H](c3ccccc3)Nc3ccccc3[C@H]21 |
| InChI | InChI=1S/C31H34N4O2/c36-30(24-16-8-10-18-27(24)34-31(37)32-22-13-5-2-6-14-22)35-20-19-25-28(21-11-3-1-4-12-21)33-26-17-9-7-15-23(26)29(25)35/h1-7,9,11-15,17,24-25,27-29,33H,8,10,16,18-20H2,(H2,32,34,37)/t24-,25+,27+,28+,29+/m0/s1 |
| InChIKey | JMAWVPBEIPDAKE-CAMSERHBSA-N |
| XLogP | 6.12 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |