C31H41N3O2 — CID 68574229
N-[(1R,2S)-2-(4-hexyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]benzamide (PubChem CID 68574229) has the molecular formula C31H41N3O2 and a molecular weight of 487.69 g/mol. Its IUPAC name is N-[(1R,2S)-2-(4-hexyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]benzamide.
| Compound Name | N-[(1R,2S)-2-(4-hexyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 68574229 |
| Molecular Formula | C31H41N3O2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | N-[(1R,2S)-2-(4-hexyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl)cyclohexyl]benzamide |
| SMILES | CCCCCCC1Nc2ccccc2C2C1CCN2C(=O)[C@H]1CCCC[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H41N3O2/c1-2-3-4-8-17-27-24-20-21-34(29(24)23-15-9-11-18-26(23)32-27)31(36)25-16-10-12-19-28(25)33-30(35)22-13-6-5-7-14-22/h5-7,9,11,13-15,18,24-25,27-29,32H,2-4,8,10,12,16-17,19-21H2,1H3,(H,33,35)/t24?,25-,27?,28+,29?/m0/s1 |
| InChIKey | HXGNZZOQKPJWBO-HENKDJBBSA-N |
| XLogP | 6.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|