C32H37N3O2 — CID 70956457
N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-methylbenzamide (PubChem CID 70956457) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-methylbenzamide.
| Compound Name | N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 70956457 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H]2CCCC[C@@H]2C(=O)N2CC[C@@H]3[C@H](C4C=CC=CC4)Nc4ccccc4[C@@H]32)c1 |
| InChI | InChI=1S/C32H37N3O2/c1-21-10-9-13-23(20-21)31(36)34-28-17-8-6-15-25(28)32(37)35-19-18-26-29(22-11-3-2-4-12-22)33-27-16-7-5-14-24(27)30(26)35/h2-5,7,9-11,13-14,16,20,22,25-26,28-30,33H,6,8,12,15,17-19H2,1H3,(H,34,36)/t22?,25-,26+,28+,29-,30-/m0/s1 |
| InChIKey | HJPSEFBACHWGSU-HISVXAFWSA-N |
| XLogP | 5.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |