C19H23N3O2 — CID 102539733
benzyl 2-[6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 102539733) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is benzyl 2-[6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | benzyl 2-[6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102539733 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | benzyl 2-[6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CNc1ccc(C2CCCCN2C(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C19H23N3O2/c1-20-18-11-10-16(13-21-18)17-9-5-6-12-22(17)19(23)24-14-15-7-3-2-4-8-15/h2-4,7-8,10-11,13,17H,5-6,9,12,14H2,1H3,(H,20,21) |
| InChIKey | YTSXVJPULKNENC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |