C22H28N2O2S — CID 102542217
benzyl 2-(6-tert-butylsulfanyl-3-pyridinyl)piperidine-1-carboxylate (PubChem CID 102542217) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is benzyl 2-(6-tert-butylsulfanyl-3-pyridinyl)piperidine-1-carboxylate.
| Compound Name | benzyl 2-(6-tert-butylsulfanyl-3-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102542217 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | benzyl 2-(6-tert-butylsulfanyl-3-pyridinyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)Sc1ccc(C2CCCCN2C(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C22H28N2O2S/c1-22(2,3)27-20-13-12-18(15-23-20)19-11-7-8-14-24(19)21(25)26-16-17-9-5-4-6-10-17/h4-6,9-10,12-13,15,19H,7-8,11,14,16H2,1-3H3 |
| InChIKey | VLMFSBZJDSVHGQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |