C19H23NO3 — CID 122033632
3-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid (PubChem CID 122033632) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid.
| Compound Name | 3-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033632 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid |
| SMILES | Cc1cccc(OCCCNCc2cccc(C(=O)O)c2)c1C |
| InChI | InChI=1S/C19H23NO3/c1-14-6-3-9-18(15(14)2)23-11-5-10-20-13-16-7-4-8-17(12-16)19(21)22/h3-4,6-9,12,20H,5,10-11,13H2,1-2H3,(H,21,22) |
| InChIKey | ATZHJVPRVGHYOL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|