C14H25NO5S2 — CID 71436049
2-[4-(2,3-dimethylphenoxy)butylamino]ethanethiol;sulfuric acid (PubChem CID 71436049) has the molecular formula C14H25NO5S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenoxy)butylamino]ethanethiol;sulfuric acid.
| Compound Name | 2-[4-(2,3-dimethylphenoxy)butylamino]ethanethiol;sulfuric acid |
|---|---|
| PubChem CID | 71436049 |
| Molecular Formula | C14H25NO5S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[4-(2,3-dimethylphenoxy)butylamino]ethanethiol;sulfuric acid |
| SMILES | Cc1cccc(OCCCCNCCS)c1C.O=S(=O)(O)O |
| InChI | InChI=1S/C14H23NOS.H2O4S/c1-12-6-5-7-14(13(12)2)16-10-4-3-8-15-9-11-17;1-5(2,3)4/h5-7,15,17H,3-4,8-11H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | LJTGSESRKCBTCS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|