4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid

C19H23NO3 — CID 122033633

IUPAC4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid
SMILESCc1cccc(OCCCNCc2ccc(C(=O)O)cc2)c1C
InChIInChI=1S/C19H23NO3/c1-14-5-3-6-18(15(14)2)23-12-4-11-20-13-16-7-9-17(10-8-16)19(21)22/h3,5-10,20H,4,11-13H2,1-2H3,(H,21,22)
InChIKeyZQATUTVEFMAJID-UHFFFAOYSA-N
MW313.40 g/mol
LogP3.56
Rot. Bonds8

About 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid

4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid (PubChem CID 122033633) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid.

Molecular Properties

Compound Name4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid
PubChem CID122033633
Molecular FormulaC19H23NO3
Molecular Weight313.40 g/mol
Exact Mass313.17
IUPAC Name4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid
SMILESCc1cccc(OCCCNCc2ccc(C(=O)O)cc2)c1C
InChIInChI=1S/C19H23NO3/c1-14-5-3-6-18(15(14)2)23-12-4-11-20-13-16-7-9-17(10-8-16)19(21)22/h3,5-10,20H,4,11-13H2,1-2H3,(H,21,22)
InChIKeyZQATUTVEFMAJID-UHFFFAOYSA-N
XLogP3.56
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.40
LogP ≤ 53.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid?
The IUPAC name of 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid (CID 122033633) is 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid.
What is the SMILES notation for 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid?
The canonical SMILES for 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid is Cc1cccc(OCCCNCc2ccc(C(=O)O)cc2)c1C.
What is the InChIKey of 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid?
The InChIKey is ZQATUTVEFMAJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO3/c1-14-5-3-6-18(15(14)2)23-12-4-11-20-13-16-7-9-17(10-8-16)19(21)22/h3,5-10,20H,4,11-13H2,1-2H3,(H,21,22).
What are the key properties of 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid?
4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid has a molecular weight of 313.40 g/mol, XLogP of 3.56, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(2,3-dimethylphenoxy)propylamino]methyl]benzoic acid is sourced from PubChem (CID 122033633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).