2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid

C19H23NO3 — CID 18802521

IUPAC2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid
SMILESCc1ccc(NCCCOc2cccc(C)c2C)c(C(=O)O)c1
InChIInChI=1S/C19H23NO3/c1-13-8-9-17(16(12-13)19(21)22)20-10-5-11-23-18-7-4-6-14(2)15(18)3/h4,6-9,12,20H,5,10-11H2,1-3H3,(H,21,22)
InChIKeyLBTYEYWCKRRUSQ-UHFFFAOYSA-N
MW313.40 g/mol
LogP4.19
Rot. Bonds7

About 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid

2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid (PubChem CID 18802521) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid.

Molecular Properties

Compound Name2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid
PubChem CID18802521
Molecular FormulaC19H23NO3
Molecular Weight313.40 g/mol
Exact Mass313.17
IUPAC Name2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid
SMILESCc1ccc(NCCCOc2cccc(C)c2C)c(C(=O)O)c1
InChIInChI=1S/C19H23NO3/c1-13-8-9-17(16(12-13)19(21)22)20-10-5-11-23-18-7-4-6-14(2)15(18)3/h4,6-9,12,20H,5,10-11H2,1-3H3,(H,21,22)
InChIKeyLBTYEYWCKRRUSQ-UHFFFAOYSA-N
XLogP4.19
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.40
LogP ≤ 54.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid?
The IUPAC name of 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid (CID 18802521) is 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid.
What is the SMILES notation for 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid?
The canonical SMILES for 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid is Cc1ccc(NCCCOc2cccc(C)c2C)c(C(=O)O)c1.
What is the InChIKey of 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid?
The InChIKey is LBTYEYWCKRRUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO3/c1-13-8-9-17(16(12-13)19(21)22)20-10-5-11-23-18-7-4-6-14(2)15(18)3/h4,6-9,12,20H,5,10-11H2,1-3H3,(H,21,22).
What are the key properties of 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid?
2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid has a molecular weight of 313.40 g/mol, XLogP of 4.19, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,3-dimethylphenoxy)propylamino]-5-methylbenzoic acid is sourced from PubChem (CID 18802521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).