C22H29NO3 — CID 18802536
2-[4-(4-tert-butylphenoxy)butylamino]-5-methylbenzoic acid (PubChem CID 18802536) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenoxy)butylamino]-5-methylbenzoic acid.
| Compound Name | 2-[4-(4-tert-butylphenoxy)butylamino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 18802536 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-[4-(4-tert-butylphenoxy)butylamino]-5-methylbenzoic acid |
| SMILES | Cc1ccc(NCCCCOc2ccc(C(C)(C)C)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H29NO3/c1-16-7-12-20(19(15-16)21(24)25)23-13-5-6-14-26-18-10-8-17(9-11-18)22(2,3)4/h7-12,15,23H,5-6,13-14H2,1-4H3,(H,24,25) |
| InChIKey | TZUBVVUPPHSQOP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|