C30H48N2O5S2 — CID 21128115
1-methyl-2-[6-[2-[2-[6-(2-methylphenoxy)hexylamino]ethylsulfanylsulfonyloxy]ethylamino]hexoxy]benzene (PubChem CID 21128115) has the molecular formula C30H48N2O5S2 and a molecular weight of 580.86 g/mol. Its IUPAC name is 1-methyl-2-[6-[2-[2-[6-(2-methylphenoxy)hexylamino]ethylsulfanylsulfonyloxy]ethylamino]hexoxy]benzene.
| Compound Name | 1-methyl-2-[6-[2-[2-[6-(2-methylphenoxy)hexylamino]ethylsulfanylsulfonyloxy]ethylamino]hexoxy]benzene |
|---|---|
| PubChem CID | 21128115 |
| Molecular Formula | C30H48N2O5S2 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 1-methyl-2-[6-[2-[2-[6-(2-methylphenoxy)hexylamino]ethylsulfanylsulfonyloxy]ethylamino]hexoxy]benzene |
| SMILES | Cc1ccccc1OCCCCCCNCCOS(=O)(=O)SCCNCCCCCCOc1ccccc1C |
| InChI | InChI=1S/C30H48N2O5S2/c1-27-15-7-9-17-29(27)35-23-13-5-3-11-19-31-21-25-37-39(33,34)38-26-22-32-20-12-4-6-14-24-36-30-18-10-8-16-28(30)2/h7-10,15-18,31-32H,3-6,11-14,19-26H2,1-2H3 |
| InChIKey | DCDVIFLKPPEURL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|