C34H40N2O5S2 — CID 21128167
[2-[2-[2-(2-benzhydryloxyethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethoxy-phenylmethyl]benzene (PubChem CID 21128167) has the molecular formula C34H40N2O5S2 and a molecular weight of 620.84 g/mol. Its IUPAC name is [2-[2-[2-(2-benzhydryloxyethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethoxy-phenylmethyl]benzene.
| Compound Name | [2-[2-[2-(2-benzhydryloxyethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethoxy-phenylmethyl]benzene |
|---|---|
| PubChem CID | 21128167 |
| Molecular Formula | C34H40N2O5S2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | [2-[2-[2-(2-benzhydryloxyethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethoxy-phenylmethyl]benzene |
| SMILES | O=S(=O)(OCCNCCOC(c1ccccc1)c1ccccc1)SCCNCCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H40N2O5S2/c37-43(38,41-27-23-35-21-25-39-33(29-13-5-1-6-14-29)30-15-7-2-8-16-30)42-28-24-36-22-26-40-34(31-17-9-3-10-18-31)32-19-11-4-12-20-32/h1-20,33-36H,21-28H2 |
| InChIKey | RCAJRFQIVHAURB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|