C22H32N2O5S2 — CID 21119902
3-[2-[2-(3-phenoxypropylamino)ethylsulfanylsulfonyloxy]ethylamino]propoxybenzene (PubChem CID 21119902) has the molecular formula C22H32N2O5S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is 3-[2-[2-(3-phenoxypropylamino)ethylsulfanylsulfonyloxy]ethylamino]propoxybenzene.
| Compound Name | 3-[2-[2-(3-phenoxypropylamino)ethylsulfanylsulfonyloxy]ethylamino]propoxybenzene |
|---|---|
| PubChem CID | 21119902 |
| Molecular Formula | C22H32N2O5S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-[2-[2-(3-phenoxypropylamino)ethylsulfanylsulfonyloxy]ethylamino]propoxybenzene |
| SMILES | O=S(=O)(OCCNCCCOc1ccccc1)SCCNCCCOc1ccccc1 |
| InChI | InChI=1S/C22H32N2O5S2/c25-31(26,29-19-15-23-13-7-17-27-21-9-3-1-4-10-21)30-20-16-24-14-8-18-28-22-11-5-2-6-12-22/h1-6,9-12,23-24H,7-8,13-20H2 |
| InChIKey | GFYADHVCWGAXEP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|