C12H19NO4S2 — CID 119088270
4-(2-sulfosulfanylethylamino)butoxybenzene (PubChem CID 119088270) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-(2-sulfosulfanylethylamino)butoxybenzene.
| Compound Name | 4-(2-sulfosulfanylethylamino)butoxybenzene |
|---|---|
| PubChem CID | 119088270 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-(2-sulfosulfanylethylamino)butoxybenzene |
| SMILES | O=S(=O)(O)SCCNCCCCOc1ccccc1 |
| InChI | InChI=1S/C12H19NO4S2/c14-19(15,16)18-11-9-13-8-4-5-10-17-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,14,15,16) |
| InChIKey | DLVHCLVKDDCDGP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|