C26H40N2O3S4 — CID 21128197
5-[2-[2-(5-phenylsulfanylpentylamino)ethylsulfanylsulfonyloxy]ethylamino]pentylsulfanylbenzene (PubChem CID 21128197) has the molecular formula C26H40N2O3S4 and a molecular weight of 556.89 g/mol. Its IUPAC name is 5-[2-[2-(5-phenylsulfanylpentylamino)ethylsulfanylsulfonyloxy]ethylamino]pentylsulfanylbenzene.
| Compound Name | 5-[2-[2-(5-phenylsulfanylpentylamino)ethylsulfanylsulfonyloxy]ethylamino]pentylsulfanylbenzene |
|---|---|
| PubChem CID | 21128197 |
| Molecular Formula | C26H40N2O3S4 |
| Molecular Weight | 556.89 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 5-[2-[2-(5-phenylsulfanylpentylamino)ethylsulfanylsulfonyloxy]ethylamino]pentylsulfanylbenzene |
| SMILES | O=S(=O)(OCCNCCCCCSc1ccccc1)SCCNCCCCCSc1ccccc1 |
| InChI | InChI=1S/C26H40N2O3S4/c29-35(30,31-21-19-27-17-9-3-11-22-32-25-13-5-1-6-14-25)34-24-20-28-18-10-4-12-23-33-26-15-7-2-8-16-26/h1-2,5-8,13-16,27-28H,3-4,9-12,17-24H2 |
| InChIKey | WGRJMVJKRVKDIO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.89 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|