C18H33N3O2 — CID 156866580
ethane;N-methyl-2-[2-(5-phenoxypentylamino)ethylamino]acetamide (PubChem CID 156866580) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is ethane;N-methyl-2-[2-(5-phenoxypentylamino)ethylamino]acetamide.
| Compound Name | ethane;N-methyl-2-[2-(5-phenoxypentylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 156866580 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | ethane;N-methyl-2-[2-(5-phenoxypentylamino)ethylamino]acetamide |
| SMILES | CC.CNC(=O)CNCCNCCCCCOc1ccccc1 |
| InChI | InChI=1S/C16H27N3O2.C2H6/c1-17-16(20)14-19-12-11-18-10-6-3-7-13-21-15-8-4-2-5-9-15;1-2/h2,4-5,8-9,18-19H,3,6-7,10-14H2,1H3,(H,17,20);1-2H3 |
| InChIKey | FEUVAWIKUQQNTD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|