C28H34N4O7S2 — CID 22213818
6-methoxy-4-[2-[2-[2-[2-(6-methoxyquinolin-4-yl)oxyethylamino]ethylsulfanylsulfonyloxy]ethylamino]ethoxy]quinoline (PubChem CID 22213818) has the molecular formula C28H34N4O7S2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 6-methoxy-4-[2-[2-[2-[2-(6-methoxyquinolin-4-yl)oxyethylamino]ethylsulfanylsulfonyloxy]ethylamino]ethoxy]quinoline.
| Compound Name | 6-methoxy-4-[2-[2-[2-[2-(6-methoxyquinolin-4-yl)oxyethylamino]ethylsulfanylsulfonyloxy]ethylamino]ethoxy]quinoline |
|---|---|
| PubChem CID | 22213818 |
| Molecular Formula | C28H34N4O7S2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 6-methoxy-4-[2-[2-[2-[2-(6-methoxyquinolin-4-yl)oxyethylamino]ethylsulfanylsulfonyloxy]ethylamino]ethoxy]quinoline |
| SMILES | COc1ccc2nccc(OCCNCCOS(=O)(=O)SCCNCCOc3ccnc4ccc(OC)cc34)c2c1 |
| InChI | InChI=1S/C28H34N4O7S2/c1-35-21-3-5-25-23(19-21)27(7-9-31-25)37-15-11-29-13-17-39-41(33,34)40-18-14-30-12-16-38-28-8-10-32-26-6-4-22(36-2)20-24(26)28/h3-10,19-20,29-30H,11-18H2,1-2H3 |
| InChIKey | VTWCTRQGENYBQR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|