C22H30INO — CID 3025137
1-[2-(2,2-diphenylethoxy)ethyl]-1-methylpiperidin-1-ium iodide (PubChem CID 3025137) has the molecular formula C22H30INO and a molecular weight of 451.39 g/mol. Its IUPAC name is 1-[2-(2,2-diphenylethoxy)ethyl]-1-methylpiperidin-1-ium iodide.
| Compound Name | 1-[2-(2,2-diphenylethoxy)ethyl]-1-methylpiperidin-1-ium iodide |
|---|---|
| PubChem CID | 3025137 |
| Molecular Formula | C22H30INO |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-[2-(2,2-diphenylethoxy)ethyl]-1-methylpiperidin-1-ium iodide |
| SMILES | C[N+]1(CCOCC(c2ccccc2)c2ccccc2)CCCCC1.[I-] |
| InChI | InChI=1S/C22H30NO.HI/c1-23(15-9-4-10-16-23)17-18-24-19-22(20-11-5-2-6-12-20)21-13-7-3-8-14-21;/h2-3,5-8,11-14,22H,4,9-10,15-19H2,1H3;1H/q+1;/p-1 |
| InChIKey | KEUHETRBFBMZGH-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|