C20H34NO2+ — CID 3030651
1-[2-[1-(4-methoxyphenyl)-2,2-dimethylpropoxy]ethyl]-1-methylpiperidin-1-ium (PubChem CID 3030651) has the molecular formula C20H34NO2+ and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-[2-[1-(4-methoxyphenyl)-2,2-dimethylpropoxy]ethyl]-1-methylpiperidin-1-ium.
| Compound Name | 1-[2-[1-(4-methoxyphenyl)-2,2-dimethylpropoxy]ethyl]-1-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 3030651 |
| Molecular Formula | C20H34NO2+ |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 1-[2-[1-(4-methoxyphenyl)-2,2-dimethylpropoxy]ethyl]-1-methylpiperidin-1-ium |
| SMILES | COc1ccc(C(OCC[N+]2(C)CCCCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H34NO2/c1-20(2,3)19(17-9-11-18(22-5)12-10-17)23-16-15-21(4)13-7-6-8-14-21/h9-12,19H,6-8,13-16H2,1-5H3/q+1 |
| InChIKey | FHAGVMIJTGKFFL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|