C17H26O3 — CID 101413027
2-hydroxy-5-(4-methoxyphenyl)-2,6,6-trimethylheptan-3-one (PubChem CID 101413027) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-hydroxy-5-(4-methoxyphenyl)-2,6,6-trimethylheptan-3-one.
| Compound Name | 2-hydroxy-5-(4-methoxyphenyl)-2,6,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 101413027 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-hydroxy-5-(4-methoxyphenyl)-2,6,6-trimethylheptan-3-one |
| SMILES | COc1ccc(C(CC(=O)C(C)(C)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26O3/c1-16(2,3)14(11-15(18)17(4,5)19)12-7-9-13(20-6)10-8-12/h7-10,14,19H,11H2,1-6H3 |
| InChIKey | FQBLXRLLWRYADB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |