C25H36BrNO — CID 159864914
1-(1-benzylpiperidin-1-ium-1-yl)-5-methyl-4-phenylhexan-3-ol bromide (PubChem CID 159864914) has the molecular formula C25H36BrNO and a molecular weight of 446.47 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-1-ium-1-yl)-5-methyl-4-phenylhexan-3-ol bromide.
| Compound Name | 1-(1-benzylpiperidin-1-ium-1-yl)-5-methyl-4-phenylhexan-3-ol bromide |
|---|---|
| PubChem CID | 159864914 |
| Molecular Formula | C25H36BrNO |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-(1-benzylpiperidin-1-ium-1-yl)-5-methyl-4-phenylhexan-3-ol bromide |
| SMILES | CC(C)C(c1ccccc1)C(O)CC[N+]1(Cc2ccccc2)CCCCC1.[Br-] |
| InChI | InChI=1S/C25H36NO.BrH/c1-21(2)25(23-14-8-4-9-15-23)24(27)16-19-26(17-10-5-11-18-26)20-22-12-6-3-7-13-22;/h3-4,6-9,12-15,21,24-25,27H,5,10-11,16-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NRPOFIKGBDVKHT-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|