C24H32NO2+ — CID 42563611
1-benzyl-1-[[(2R,4R)-2-[(1R)-1-phenylethyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium (PubChem CID 42563611) has the molecular formula C24H32NO2+ and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-benzyl-1-[[(2R,4R)-2-[(1R)-1-phenylethyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium.
| Compound Name | 1-benzyl-1-[[(2R,4R)-2-[(1R)-1-phenylethyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 42563611 |
| Molecular Formula | C24H32NO2+ |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-benzyl-1-[[(2R,4R)-2-[(1R)-1-phenylethyl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
| SMILES | C[C@H](c1ccccc1)[C@@H]1OC[C@@H](C[N+]2(Cc3ccccc3)CCCCC2)O1 |
| InChI | InChI=1S/C24H32NO2/c1-20(22-13-7-3-8-14-22)24-26-19-23(27-24)18-25(15-9-4-10-16-25)17-21-11-5-2-6-12-21/h2-3,5-8,11-14,20,23-24H,4,9-10,15-19H2,1H3/q+1/t20-,23-,24-/m1/s1 |
| InChIKey | JDFNXYLSSCARAW-AGILITTLSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|