C27H38NO+ — CID 160858091
5-methyl-4-phenyl-1-[1-(3-phenylprop-2-enyl)piperidin-1-ium-1-yl]hexan-3-ol (PubChem CID 160858091) has the molecular formula C27H38NO+ and a molecular weight of 392.61 g/mol. Its IUPAC name is 5-methyl-4-phenyl-1-[1-(3-phenylprop-2-enyl)piperidin-1-ium-1-yl]hexan-3-ol.
| Compound Name | 5-methyl-4-phenyl-1-[1-(3-phenylprop-2-enyl)piperidin-1-ium-1-yl]hexan-3-ol |
|---|---|
| PubChem CID | 160858091 |
| Molecular Formula | C27H38NO+ |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 5-methyl-4-phenyl-1-[1-(3-phenylprop-2-enyl)piperidin-1-ium-1-yl]hexan-3-ol |
| SMILES | CC(C)C(c1ccccc1)C(O)CC[N+]1(CC=Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C27H38NO/c1-23(2)27(25-16-8-4-9-17-25)26(29)18-22-28(19-10-5-11-20-28)21-12-15-24-13-6-3-7-14-24/h3-4,6-9,12-17,23,26-27,29H,5,10-11,18-22H2,1-2H3/q+1 |
| InChIKey | GDZGBZRFQISHPH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|