C20H26NO2+ — CID 24840356
3-(4-methylmorpholin-4-ium-4-yl)-1,1-diphenylpropan-1-ol (PubChem CID 24840356) has the molecular formula C20H26NO2+ and a molecular weight of 312.43 g/mol. Its IUPAC name is 3-(4-methylmorpholin-4-ium-4-yl)-1,1-diphenylpropan-1-ol.
| Compound Name | 3-(4-methylmorpholin-4-ium-4-yl)-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 24840356 |
| Molecular Formula | C20H26NO2+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-(4-methylmorpholin-4-ium-4-yl)-1,1-diphenylpropan-1-ol |
| SMILES | C[N+]1(CCC(O)(c2ccccc2)c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C20H26NO2/c1-21(14-16-23-17-15-21)13-12-20(22,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,22H,12-17H2,1H3/q+1 |
| InChIKey | HTJGQQAPLHBWCK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|