C16H26NO+ — CID 101381465
(1S)-1-phenyl-2-[(2R,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]ethanol (PubChem CID 101381465) has the molecular formula C16H26NO+ and a molecular weight of 248.39 g/mol. Its IUPAC name is (1S)-1-phenyl-2-[(2R,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]ethanol.
| Compound Name | (1S)-1-phenyl-2-[(2R,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 101381465 |
| Molecular Formula | C16H26NO+ |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | (1S)-1-phenyl-2-[(2R,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]ethanol |
| SMILES | C[C@@H]1CCC[C@@H](C)[N+]1(C)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H26NO/c1-13-8-7-9-14(2)17(13,3)12-16(18)15-10-5-4-6-11-15/h4-6,10-11,13-14,16,18H,7-9,12H2,1-3H3/q+1/t13-,14-,16-/m1/s1 |
| InChIKey | AQEAKGHPZMXIMN-IIAWOOMASA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|