C20H31NO — CID 10946557
2-(dicyclohexylamino)-1-phenylethanol (PubChem CID 10946557) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 2-(dicyclohexylamino)-1-phenylethanol.
| Compound Name | 2-(dicyclohexylamino)-1-phenylethanol |
|---|---|
| PubChem CID | 10946557 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 2-(dicyclohexylamino)-1-phenylethanol |
| SMILES | OC(CN(C1CCCCC1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H31NO/c22-20(17-10-4-1-5-11-17)16-21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1,4-5,10-11,18-20,22H,2-3,6-9,12-16H2 |
| InChIKey | KARKZTTXDGSKJW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |