C21H26ClNO — CID 92858666
(1R)-2-[benzyl(cyclohexyl)amino]-1-(4-chlorophenyl)ethanol (PubChem CID 92858666) has the molecular formula C21H26ClNO and a molecular weight of 343.90 g/mol. Its IUPAC name is (1R)-2-[benzyl(cyclohexyl)amino]-1-(4-chlorophenyl)ethanol.
| Compound Name | (1R)-2-[benzyl(cyclohexyl)amino]-1-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 92858666 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (1R)-2-[benzyl(cyclohexyl)amino]-1-(4-chlorophenyl)ethanol |
| SMILES | O[C@@H](CN(Cc1ccccc1)C1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26ClNO/c22-19-13-11-18(12-14-19)21(24)16-23(20-9-5-2-6-10-20)15-17-7-3-1-4-8-17/h1,3-4,7-8,11-14,20-21,24H,2,5-6,9-10,15-16H2/t21-/m0/s1 |
| InChIKey | ORLHMXYPJWTLGW-NRFANRHFSA-N |
| XLogP | 5.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |