C14H24N2O — CID 71792630
2,2-dimethyl-N-(4-piperidin-1-ylbut-2-ynyl)propanamide (PubChem CID 71792630) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-piperidin-1-ylbut-2-ynyl)propanamide.
| Compound Name | 2,2-dimethyl-N-(4-piperidin-1-ylbut-2-ynyl)propanamide |
|---|---|
| PubChem CID | 71792630 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2,2-dimethyl-N-(4-piperidin-1-ylbut-2-ynyl)propanamide |
| SMILES | CC(C)(C)C(=O)NCC#CCN1CCCCC1 |
| InChI | InChI=1S/C14H24N2O/c1-14(2,3)13(17)15-9-5-8-12-16-10-6-4-7-11-16/h4,6-7,9-12H2,1-3H3,(H,15,17) |
| InChIKey | QIPCOLKGNZCAEL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|