C25H42OSi — CID 135062450
(E)-1-cyclohexyl-5-methyl-1-phenyl-3-triethylsilylhex-3-en-1-ol (PubChem CID 135062450) has the molecular formula C25H42OSi and a molecular weight of 386.70 g/mol. Its IUPAC name is (E)-1-cyclohexyl-5-methyl-1-phenyl-3-triethylsilylhex-3-en-1-ol.
| Compound Name | (E)-1-cyclohexyl-5-methyl-1-phenyl-3-triethylsilylhex-3-en-1-ol |
|---|---|
| PubChem CID | 135062450 |
| Molecular Formula | C25H42OSi |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | (E)-1-cyclohexyl-5-methyl-1-phenyl-3-triethylsilylhex-3-en-1-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/C(C)C)CC(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H42OSi/c1-6-27(7-2,8-3)24(19-21(4)5)20-25(26,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9,11-12,15-16,19,21,23,26H,6-8,10,13-14,17-18,20H2,1-5H3/b24-19+ |
| InChIKey | HSSAQIOKVXZLAU-LYBHJNIJSA-N |
| XLogP | 7.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|