C23H38OSi — CID 135061732
(E)-1-cyclohexyl-1-phenyl-3-triethylsilylpent-3-en-1-ol (PubChem CID 135061732) has the molecular formula C23H38OSi and a molecular weight of 358.64 g/mol. Its IUPAC name is (E)-1-cyclohexyl-1-phenyl-3-triethylsilylpent-3-en-1-ol.
| Compound Name | (E)-1-cyclohexyl-1-phenyl-3-triethylsilylpent-3-en-1-ol |
|---|---|
| PubChem CID | 135061732 |
| Molecular Formula | C23H38OSi |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (E)-1-cyclohexyl-1-phenyl-3-triethylsilylpent-3-en-1-ol |
| SMILES | C/C=C(\CC(O)(c1ccccc1)C1CCCCC1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H38OSi/c1-5-22(25(6-2,7-3)8-4)19-23(24,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h5,9,11-12,15-16,21,24H,6-8,10,13-14,17-19H2,1-4H3/b22-5+ |
| InChIKey | NVJCDUGXGNYMLI-RREIPUBJSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|