C19H33N2OSi+ — CID 123770807
1-cyclohexyl-2-(4-methyl-4-silylpiperazin-4-ium-1-yl)-1-phenylethanol (PubChem CID 123770807) has the molecular formula C19H33N2OSi+ and a molecular weight of 333.57 g/mol. Its IUPAC name is 1-cyclohexyl-2-(4-methyl-4-silylpiperazin-4-ium-1-yl)-1-phenylethanol.
| Compound Name | 1-cyclohexyl-2-(4-methyl-4-silylpiperazin-4-ium-1-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 123770807 |
| Molecular Formula | C19H33N2OSi+ |
| Molecular Weight | 333.57 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 1-cyclohexyl-2-(4-methyl-4-silylpiperazin-4-ium-1-yl)-1-phenylethanol |
| SMILES | C[N+]1([SiH3])CCN(CC(O)(c2ccccc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H33N2OSi/c1-21(23)14-12-20(13-15-21)16-19(22,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2,4-5,8-9,18,22H,3,6-7,10-16H2,1,23H3/q+1 |
| InChIKey | NPNXPJMTHYXCHW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|