C19H29N3O — CID 88623213
1-cyclopentyl-2-[4-(2-iminoethyl)piperazin-1-yl]-1-phenylethanol (PubChem CID 88623213) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-cyclopentyl-2-[4-(2-iminoethyl)piperazin-1-yl]-1-phenylethanol.
| Compound Name | 1-cyclopentyl-2-[4-(2-iminoethyl)piperazin-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 88623213 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 1-cyclopentyl-2-[4-(2-iminoethyl)piperazin-1-yl]-1-phenylethanol |
| SMILES | [H]/N=C/CN1CCN(CC(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C19H29N3O/c20-10-11-21-12-14-22(15-13-21)16-19(23,18-8-4-5-9-18)17-6-2-1-3-7-17/h1-3,6-7,10,18,20,23H,4-5,8-9,11-16H2/b20-10+ |
| InChIKey | UZPGIIKMONAXOY-KEBDBYFISA-N |
| XLogP | 2.33 |
| TPSA | 50.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|