About cyclohexanamine;diphenylmethanediamine
cyclohexanamine;diphenylmethanediamine (PubChem CID 175293358) has the molecular formula C19H27N3
and a molecular weight of 297.45 g/mol. Its IUPAC name is cyclohexanamine;diphenylmethanediamine.
Molecular Properties
| Compound Name | cyclohexanamine;diphenylmethanediamine |
| PubChem CID | 175293358 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | cyclohexanamine;diphenylmethanediamine |
| SMILES | NC(N)(c1ccccc1)c1ccccc1.NC1CCCCC1 |
| InChI | InChI=1S/C13H14N2.C6H13N/c14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-10H,14-15H2;6H,1-5,7H2 |
| InChIKey | RTEBIIFZVNOIMM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;diphenylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;diphenylmethanediamine?
The IUPAC name of cyclohexanamine;diphenylmethanediamine (CID 175293358) is cyclohexanamine;diphenylmethanediamine.
What is the SMILES notation for cyclohexanamine;diphenylmethanediamine?
The canonical SMILES for cyclohexanamine;diphenylmethanediamine is NC(N)(c1ccccc1)c1ccccc1.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;diphenylmethanediamine?
The InChIKey is RTEBIIFZVNOIMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.C6H13N/c14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-10H,14-15H2;6H,1-5,7H2.
What are the key properties of cyclohexanamine;diphenylmethanediamine?
cyclohexanamine;diphenylmethanediamine has a molecular weight of 297.45 g/mol, XLogP of 3.08, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;diphenylmethanediamine is sourced from PubChem (CID 175293358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).