About (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine
(2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine (PubChem CID 112756113) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine.
Molecular Properties
| Compound Name | (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine |
| PubChem CID | 112756113 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine |
| SMILES | C[C@](N=[N+]=[N-])(C(=O)O)c1ccccc1.NC1CCCCC1 |
| InChI | InChI=1S/C9H9N3O2.C6H13N/c1-9(8(13)14,11-12-10)7-5-3-2-4-6-7;7-6-4-2-1-3-5-6/h2-6H,1H3,(H,13,14);6H,1-5,7H2/t9-;/m1./s1 |
| InChIKey | ZTGXMUQBMULOTK-SBSPUUFOSA-N |
| XLogP | 3.57 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine?
The IUPAC name of (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine (CID 112756113) is (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine.
What is the SMILES notation for (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine?
The canonical SMILES for (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine is C[C@](N=[N+]=[N-])(C(=O)O)c1ccccc1.NC1CCCCC1.
What is the InChIKey of (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine?
The InChIKey is ZTGXMUQBMULOTK-SBSPUUFOSA-N. The full InChI is InChI=1S/C9H9N3O2.C6H13N/c1-9(8(13)14,11-12-10)7-5-3-2-4-6-7;7-6-4-2-1-3-5-6/h2-6H,1H3,(H,13,14);6H,1-5,7H2/t9-;/m1./s1.
What are the key properties of (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine?
(2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine has a molecular weight of 290.37 g/mol, XLogP of 3.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-azido-2-phenylpropanoic acid;cyclohexanamine is sourced from PubChem (CID 112756113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).